About N-cyclohepta-1,3,6-trien-1-yl-N-(2-methylbutan-2-yl)propanamide
N-cyclohepta-1,3,6-trien-1-yl-N-(2-methylbutan-2-yl)propanamide (PubChem CID 153346824) has the molecular formula C15H23NO
and a molecular weight of 233.35 g/mol. Its IUPAC name is N-cyclohepta-1,3,6-trien-1-yl-N-(2-methylbutan-2-yl)propanamide.
Molecular Properties
| Compound Name | N-cyclohepta-1,3,6-trien-1-yl-N-(2-methylbutan-2-yl)propanamide |
| PubChem CID | 153346824 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | N-cyclohepta-1,3,6-trien-1-yl-N-(2-methylbutan-2-yl)propanamide |
| SMILES | CCC(=O)N(C1=CC=CCC=C1)C(C)(C)CC |
| InChI | InChI=1S/C15H23NO/c1-5-14(17)16(15(3,4)6-2)13-11-9-7-8-10-12-13/h7,9-12H,5-6,8H2,1-4H3 |
| InChIKey | BWJYKRFCAUXMIV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclohepta-1,3,6-trien-1-yl-N-(2-methylbutan-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohepta-1,3,6-trien-1-yl-N-(2-methylbutan-2-yl)propanamide?
The IUPAC name of N-cyclohepta-1,3,6-trien-1-yl-N-(2-methylbutan-2-yl)propanamide (CID 153346824) is N-cyclohepta-1,3,6-trien-1-yl-N-(2-methylbutan-2-yl)propanamide.
What is the SMILES notation for N-cyclohepta-1,3,6-trien-1-yl-N-(2-methylbutan-2-yl)propanamide?
The canonical SMILES for N-cyclohepta-1,3,6-trien-1-yl-N-(2-methylbutan-2-yl)propanamide is CCC(=O)N(C1=CC=CCC=C1)C(C)(C)CC.
What is the InChIKey of N-cyclohepta-1,3,6-trien-1-yl-N-(2-methylbutan-2-yl)propanamide?
The InChIKey is BWJYKRFCAUXMIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO/c1-5-14(17)16(15(3,4)6-2)13-11-9-7-8-10-12-13/h7,9-12H,5-6,8H2,1-4H3.
What are the key properties of N-cyclohepta-1,3,6-trien-1-yl-N-(2-methylbutan-2-yl)propanamide?
N-cyclohepta-1,3,6-trien-1-yl-N-(2-methylbutan-2-yl)propanamide has a molecular weight of 233.35 g/mol, XLogP of 3.81, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohepta-1,3,6-trien-1-yl-N-(2-methylbutan-2-yl)propanamide is sourced from PubChem (CID 153346824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).