C22H31N5O2 — CID 153347157
N-[[3-amino-4-[amino(methyl)amino]phenyl]methyl]-4-[(4-methoxyphenyl)methyl]-1-methylpyrrolidine-2-carboxamide (PubChem CID 153347157) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[[3-amino-4-[amino(methyl)amino]phenyl]methyl]-4-[(4-methoxyphenyl)methyl]-1-methylpyrrolidine-2-carboxamide.
| Compound Name | N-[[3-amino-4-[amino(methyl)amino]phenyl]methyl]-4-[(4-methoxyphenyl)methyl]-1-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 153347157 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | N-[[3-amino-4-[amino(methyl)amino]phenyl]methyl]-4-[(4-methoxyphenyl)methyl]-1-methylpyrrolidine-2-carboxamide |
| SMILES | COc1ccc(CC2CC(C(=O)NCc3ccc(N(C)N)c(N)c3)N(C)C2)cc1 |
| InChI | InChI=1S/C22H31N5O2/c1-26-14-17(10-15-4-7-18(29-3)8-5-15)12-21(26)22(28)25-13-16-6-9-20(27(2)24)19(23)11-16/h4-9,11,17,21H,10,12-14,23-24H2,1-3H3,(H,25,28) |
| InChIKey | PAAQDEDXMJJEJB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|