C18H25N5O2 — CID 153347205
but-1-ene;(2S)-1-formyl-N-[(1-methylbenzotriazol-5-yl)methyl]pyrrolidine-2-carboxamide (PubChem CID 153347205) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is but-1-ene;(2S)-1-formyl-N-[(1-methylbenzotriazol-5-yl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | but-1-ene;(2S)-1-formyl-N-[(1-methylbenzotriazol-5-yl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 153347205 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | but-1-ene;(2S)-1-formyl-N-[(1-methylbenzotriazol-5-yl)methyl]pyrrolidine-2-carboxamide |
| SMILES | C=CCC.Cn1nnc2cc(CNC(=O)[C@@H]3CCCN3C=O)ccc21 |
| InChI | InChI=1S/C14H17N5O2.C4H8/c1-18-12-5-4-10(7-11(12)16-17-18)8-15-14(21)13-3-2-6-19(13)9-20;1-3-4-2/h4-5,7,9,13H,2-3,6,8H2,1H3,(H,15,21);3H,1,4H2,2H3/t13-;/m0./s1 |
| InChIKey | VPXRJMYUFMNMES-ZOWNYOTGSA-N |
| XLogP | 1.79 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|