C35H58N4O3 — CID 153347453
N-(4-amino-3-hydroxybutyl)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide;2,5-dimethylhex-1-ene;toluene (PubChem CID 153347453) has the molecular formula C35H58N4O3 and a molecular weight of 582.87 g/mol. Its IUPAC name is N-(4-amino-3-hydroxybutyl)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide;2,5-dimethylhex-1-ene;toluene.
| Compound Name | N-(4-amino-3-hydroxybutyl)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide;2,5-dimethylhex-1-ene;toluene |
|---|---|
| PubChem CID | 153347453 |
| Molecular Formula | C35H58N4O3 |
| Molecular Weight | 582.87 g/mol |
| Exact Mass | 582.45 |
| IUPAC Name | N-(4-amino-3-hydroxybutyl)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanamide;2,5-dimethylhex-1-ene;toluene |
| SMILES | C=C(C)CCC(C)C.CC(C)C(C(=O)NCCC(O)CN)N1CCCNC1=O.Cc1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C13H26N4O3.C8H16.2C7H8/c1-9(2)11(17-7-3-5-16-13(17)20)12(19)15-6-4-10(18)8-14;1-7(2)5-6-8(3)4;2*1-7-5-3-2-4-6-7/h9-11,18H,3-8,14H2,1-2H3,(H,15,19)(H,16,20);8H,1,5-6H2,2-4H3;2*2-6H,1H3 |
| InChIKey | IXPSOXLONMPITN-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.87 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|