C12H12LiN3O3S — CID 153347507
lithium N,N-bis(pyridin-3-ylmethyl)sulfamate (PubChem CID 153347507) has the molecular formula C12H12LiN3O3S and a molecular weight of 285.25 g/mol. Its IUPAC name is lithium N,N-bis(pyridin-3-ylmethyl)sulfamate.
| Compound Name | lithium N,N-bis(pyridin-3-ylmethyl)sulfamate |
|---|---|
| PubChem CID | 153347507 |
| Molecular Formula | C12H12LiN3O3S |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | lithium N,N-bis(pyridin-3-ylmethyl)sulfamate |
| SMILES | O=S(=O)([O-])N(Cc1cccnc1)Cc1cccnc1.[Li+] |
| InChI | InChI=1S/C12H13N3O3S.Li/c16-19(17,18)15(9-11-3-1-5-13-7-11)10-12-4-2-6-14-8-12;/h1-8H,9-10H2,(H,16,17,18);/q;+1/p-1 |
| InChIKey | MZYOCHABDJCWEI-UHFFFAOYSA-M |
| XLogP | -2.06 |
| TPSA | 86.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|