C24H32N6O — CID 153348863
2-[3-[(3R)-3-(tert-butylamino)pyrrolidin-1-yl]-5-ethyl-4H-diazepin-7-yl]-5-(1H-pyrazol-4-yl)phenol (PubChem CID 153348863) has the molecular formula C24H32N6O and a molecular weight of 420.56 g/mol. Its IUPAC name is 2-[3-[(3R)-3-(tert-butylamino)pyrrolidin-1-yl]-5-ethyl-4H-diazepin-7-yl]-5-(1H-pyrazol-4-yl)phenol.
| Compound Name | 2-[3-[(3R)-3-(tert-butylamino)pyrrolidin-1-yl]-5-ethyl-4H-diazepin-7-yl]-5-(1H-pyrazol-4-yl)phenol |
|---|---|
| PubChem CID | 153348863 |
| Molecular Formula | C24H32N6O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | 2-[3-[(3R)-3-(tert-butylamino)pyrrolidin-1-yl]-5-ethyl-4H-diazepin-7-yl]-5-(1H-pyrazol-4-yl)phenol |
| SMILES | CCC1=CC(c2ccc(-c3cn[nH]c3)cc2O)=NN=C(N2CC[C@@H](NC(C)(C)C)C2)C1 |
| InChI | InChI=1S/C24H32N6O/c1-5-16-10-21(20-7-6-17(12-22(20)31)18-13-25-26-14-18)28-29-23(11-16)30-9-8-19(15-30)27-24(2,3)4/h6-7,10,12-14,19,27,31H,5,8-9,11,15H2,1-4H3,(H,25,26)/t19-/m1/s1 |
| InChIKey | FWCHBBAOVXWQEJ-LJQANCHMSA-N |
| XLogP | 4.09 |
| TPSA | 88.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|