C14H19N3O — CID 153349000
3-amino-N-isoquinolin-6-ylpropanamide;ethane (PubChem CID 153349000) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 3-amino-N-isoquinolin-6-ylpropanamide;ethane.
| Compound Name | 3-amino-N-isoquinolin-6-ylpropanamide;ethane |
|---|---|
| PubChem CID | 153349000 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 3-amino-N-isoquinolin-6-ylpropanamide;ethane |
| SMILES | CC.NCCC(=O)Nc1ccc2cnccc2c1 |
| InChI | InChI=1S/C12H13N3O.C2H6/c13-5-3-12(16)15-11-2-1-10-8-14-6-4-9(10)7-11;1-2/h1-2,4,6-8H,3,5,13H2,(H,15,16);1-2H3 |
| InChIKey | LAGKYJFKIJLSEP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |