C19H20ClN5O7S — CID 153349480
(2S)-2-[3-[(E)-2-[(2-chloro-3,4-dihydroxybenzoyl)amino]ethylideneamino]-5-methyl-2-oxoimidazolidin-1-yl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid (PubChem CID 153349480) has the molecular formula C19H20ClN5O7S and a molecular weight of 497.92 g/mol. Its IUPAC name is (2S)-2-[3-[(E)-2-[(2-chloro-3,4-dihydroxybenzoyl)amino]ethylideneamino]-5-methyl-2-oxoimidazolidin-1-yl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid.
| Compound Name | (2S)-2-[3-[(E)-2-[(2-chloro-3,4-dihydroxybenzoyl)amino]ethylideneamino]-5-methyl-2-oxoimidazolidin-1-yl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid |
|---|---|
| PubChem CID | 153349480 |
| Molecular Formula | C19H20ClN5O7S |
| Molecular Weight | 497.92 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | (2S)-2-[3-[(E)-2-[(2-chloro-3,4-dihydroxybenzoyl)amino]ethylideneamino]-5-methyl-2-oxoimidazolidin-1-yl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid |
| SMILES | CC1CN(/N=C/CNC(=O)c2ccc(O)c(O)c2Cl)C(=O)N1[C@@H]1C(C(=O)O)SC2CC(=O)N21 |
| InChI | InChI=1S/C19H20ClN5O7S/c1-8-7-23(22-5-4-21-16(29)9-2-3-10(26)14(28)13(9)20)19(32)24(8)17-15(18(30)31)33-12-6-11(27)25(12)17/h2-3,5,8,12,15,17,26,28H,4,6-7H2,1H3,(H,21,29)(H,30,31)/b22-5+/t8?,12?,15?,17-/m0/s1 |
| InChIKey | MMJZTAJMKPQBHP-HZZVEPDUSA-N |
| XLogP | 0.68 |
| TPSA | 163.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.92 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|