C20H21ClN6O8S — CID 153349499
3-[3-[(E)-[2-[2-[(2-chloro-3,4-dihydroxybenzoyl)amino]ethylamino]-2-oxoethylidene]amino]-2-oxoimidazolidin-1-yl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid (PubChem CID 153349499) has the molecular formula C20H21ClN6O8S and a molecular weight of 540.94 g/mol. Its IUPAC name is 3-[3-[(E)-[2-[2-[(2-chloro-3,4-dihydroxybenzoyl)amino]ethylamino]-2-oxoethylidene]amino]-2-oxoimidazolidin-1-yl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid.
| Compound Name | 3-[3-[(E)-[2-[2-[(2-chloro-3,4-dihydroxybenzoyl)amino]ethylamino]-2-oxoethylidene]amino]-2-oxoimidazolidin-1-yl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid |
|---|---|
| PubChem CID | 153349499 |
| Molecular Formula | C20H21ClN6O8S |
| Molecular Weight | 540.94 g/mol |
| Exact Mass | 540.08 |
| IUPAC Name | 3-[3-[(E)-[2-[2-[(2-chloro-3,4-dihydroxybenzoyl)amino]ethylamino]-2-oxoethylidene]amino]-2-oxoimidazolidin-1-yl]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-3-carboxylic acid |
| SMILES | O=C(/C=N/N1CCN(C2(C(=O)O)CN3C(=O)CC3S2)C1=O)NCCNC(=O)c1ccc(O)c(O)c1Cl |
| InChI | InChI=1S/C20H21ClN6O8S/c21-15-10(1-2-11(28)16(15)31)17(32)23-4-3-22-12(29)8-24-27-6-5-26(19(27)35)20(18(33)34)9-25-13(30)7-14(25)36-20/h1-2,8,14,28,31H,3-7,9H2,(H,22,29)(H,23,32)(H,33,34)/b24-8+ |
| InChIKey | HUKXJPKQJHNXCC-KTZMUZOWSA-N |
| XLogP | -0.59 |
| TPSA | 192.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.94 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|