C11H20N2O3 — CID 153349641
5-(dimethylamino)-6-ethoxy-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazol-2-one (PubChem CID 153349641) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 5-(dimethylamino)-6-ethoxy-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-(dimethylamino)-6-ethoxy-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 153349641 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 5-(dimethylamino)-6-ethoxy-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzoxazol-2-one |
| SMILES | CCOC1CC2OC(=O)NC2CC1N(C)C |
| InChI | InChI=1S/C11H20N2O3/c1-4-15-10-6-9-7(12-11(14)16-9)5-8(10)13(2)3/h7-10H,4-6H2,1-3H3,(H,12,14) |
| InChIKey | MBGTZBZNVMMSLP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |