C24H31N7 — CID 153349873
N-[[5-(6-methyl-2-pyridinyl)-4-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-1H-imidazol-2-yl]methyl]octan-3-amine (PubChem CID 153349873) has the molecular formula C24H31N7 and a molecular weight of 417.56 g/mol. Its IUPAC name is N-[[5-(6-methyl-2-pyridinyl)-4-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-1H-imidazol-2-yl]methyl]octan-3-amine.
| Compound Name | N-[[5-(6-methyl-2-pyridinyl)-4-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-1H-imidazol-2-yl]methyl]octan-3-amine |
|---|---|
| PubChem CID | 153349873 |
| Molecular Formula | C24H31N7 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | N-[[5-(6-methyl-2-pyridinyl)-4-([1,2,4]triazolo[1,5-a]pyridin-6-yl)-1H-imidazol-2-yl]methyl]octan-3-amine |
| SMILES | CCCCCC(CC)NCc1nc(-c2ccc3ncnn3c2)c(-c2cccc(C)n2)[nH]1 |
| InChI | InChI=1S/C24H31N7/c1-4-6-7-10-19(5-2)25-14-21-29-23(18-12-13-22-26-16-27-31(22)15-18)24(30-21)20-11-8-9-17(3)28-20/h8-9,11-13,15-16,19,25H,4-7,10,14H2,1-3H3,(H,29,30) |
| InChIKey | ZFWSHNVXCFGWOE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|