About 3-ethyl-4H-1,2,4-oxadiazol-5-one;molecular hydrogen
3-ethyl-4H-1,2,4-oxadiazol-5-one;molecular hydrogen (PubChem CID 153349929) has the molecular formula C4H8N2O2
and a molecular weight of 116.12 g/mol. Its IUPAC name is 3-ethyl-4H-1,2,4-oxadiazol-5-one;molecular hydrogen.
Molecular Properties
| Compound Name | 3-ethyl-4H-1,2,4-oxadiazol-5-one;molecular hydrogen |
| PubChem CID | 153349929 |
| Molecular Formula | C4H8N2O2 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | 3-ethyl-4H-1,2,4-oxadiazol-5-one;molecular hydrogen |
| SMILES | CCc1noc(=O)[nH]1.[H][H] |
| InChI | InChI=1S/C4H6N2O2.H2/c1-2-3-5-4(7)8-6-3;/h2H2,1H3,(H,5,6,7);1H |
| InChIKey | XCFAQMVWPJTCIO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-4H-1,2,4-oxadiazol-5-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4H-1,2,4-oxadiazol-5-one;molecular hydrogen?
The IUPAC name of 3-ethyl-4H-1,2,4-oxadiazol-5-one;molecular hydrogen (CID 153349929) is 3-ethyl-4H-1,2,4-oxadiazol-5-one;molecular hydrogen.
What is the SMILES notation for 3-ethyl-4H-1,2,4-oxadiazol-5-one;molecular hydrogen?
The canonical SMILES for 3-ethyl-4H-1,2,4-oxadiazol-5-one;molecular hydrogen is CCc1noc(=O)[nH]1.[H][H].
What is the InChIKey of 3-ethyl-4H-1,2,4-oxadiazol-5-one;molecular hydrogen?
The InChIKey is XCFAQMVWPJTCIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2.H2/c1-2-3-5-4(7)8-6-3;/h2H2,1H3,(H,5,6,7);1H.
What are the key properties of 3-ethyl-4H-1,2,4-oxadiazol-5-one;molecular hydrogen?
3-ethyl-4H-1,2,4-oxadiazol-5-one;molecular hydrogen has a molecular weight of 116.12 g/mol, XLogP of 0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4H-1,2,4-oxadiazol-5-one;molecular hydrogen is sourced from PubChem (CID 153349929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).