About ethane;3-ethyl-4H-1,2,4-oxadiazol-5-one
ethane;3-ethyl-4H-1,2,4-oxadiazol-5-one (PubChem CID 153349931) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is ethane;3-ethyl-4H-1,2,4-oxadiazol-5-one.
Molecular Properties
| Compound Name | ethane;3-ethyl-4H-1,2,4-oxadiazol-5-one |
| PubChem CID | 153349931 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | ethane;3-ethyl-4H-1,2,4-oxadiazol-5-one |
| SMILES | CC.CCc1noc(=O)[nH]1 |
| InChI | InChI=1S/C4H6N2O2.C2H6/c1-2-3-5-4(7)8-6-3;1-2/h2H2,1H3,(H,5,6,7);1-2H3 |
| InChIKey | MQAQFMONVKGCBK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-ethyl-4H-1,2,4-oxadiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethyl-4H-1,2,4-oxadiazol-5-one?
The IUPAC name of ethane;3-ethyl-4H-1,2,4-oxadiazol-5-one (CID 153349931) is ethane;3-ethyl-4H-1,2,4-oxadiazol-5-one.
What is the SMILES notation for ethane;3-ethyl-4H-1,2,4-oxadiazol-5-one?
The canonical SMILES for ethane;3-ethyl-4H-1,2,4-oxadiazol-5-one is CC.CCc1noc(=O)[nH]1.
What is the InChIKey of ethane;3-ethyl-4H-1,2,4-oxadiazol-5-one?
The InChIKey is MQAQFMONVKGCBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2.C2H6/c1-2-3-5-4(7)8-6-3;1-2/h2H2,1H3,(H,5,6,7);1-2H3.
What are the key properties of ethane;3-ethyl-4H-1,2,4-oxadiazol-5-one?
ethane;3-ethyl-4H-1,2,4-oxadiazol-5-one has a molecular weight of 144.17 g/mol, XLogP of 0.95, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethyl-4H-1,2,4-oxadiazol-5-one is sourced from PubChem (CID 153349931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).