C24H22IN4O8- — CID 153350092
CID 153350092 (PubChem CID 153350092) has the molecular formula C24H22IN4O8- and a molecular weight of 621.36 g/mol.
| Compound Name | CID 153350092 |
|---|---|
| PubChem CID | 153350092 |
| Molecular Formula | C24H22IN4O8- |
| Molecular Weight | 621.36 g/mol |
| Exact Mass | 621.05 |
| IUPAC Name | — |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc3c(cc1c2COCNC(=O)CN)O[I-]O3 |
| InChI | InChI=1S/C24H22IN4O8/c1-2-24(33)15-4-17-21-12(7-29(17)22(31)14(15)9-35-23(24)32)13(8-34-10-27-20(30)6-26)11-3-18-19(37-25-36-18)5-16(11)28-21/h3-5,33H,2,6-10,26H2,1H3,(H,27,30)/q-1/t24-/m0/s1 |
| InChIKey | ICYHIEPJIUBAHB-DEOSSOPVSA-N |
| XLogP | -2.68 |
| TPSA | 164.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.36 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|