C15H18O2 — CID 153350231
3-cyclohexa-1,5-dien-1-yl-2-hydroxybenzaldehyde;ethane (PubChem CID 153350231) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-2-hydroxybenzaldehyde;ethane.
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-2-hydroxybenzaldehyde;ethane |
|---|---|
| PubChem CID | 153350231 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-2-hydroxybenzaldehyde;ethane |
| SMILES | CC.O=Cc1cccc(C2=CCCC=C2)c1O |
| InChI | InChI=1S/C13H12O2.C2H6/c14-9-11-7-4-8-12(13(11)15)10-5-2-1-3-6-10;1-2/h2,4-9,15H,1,3H2;1-2H3 |
| InChIKey | JXOIOAKFKNONMR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|