C10H10F3N3O3 — CID 15335027
N-(4,6-dimethoxypyrimidin-2-yl)-3,4,4-trifluorobut-3-enamide (PubChem CID 15335027) has the molecular formula C10H10F3N3O3 and a molecular weight of 277.20 g/mol. Its IUPAC name is N-(4,6-dimethoxypyrimidin-2-yl)-3,4,4-trifluorobut-3-enamide.
| Compound Name | N-(4,6-dimethoxypyrimidin-2-yl)-3,4,4-trifluorobut-3-enamide |
|---|---|
| PubChem CID | 15335027 |
| Molecular Formula | C10H10F3N3O3 |
| Molecular Weight | 277.20 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-(4,6-dimethoxypyrimidin-2-yl)-3,4,4-trifluorobut-3-enamide |
| SMILES | COc1cc(OC)nc(NC(=O)CC(F)=C(F)F)n1 |
| InChI | InChI=1S/C10H10F3N3O3/c1-18-7-4-8(19-2)16-10(15-7)14-6(17)3-5(11)9(12)13/h4H,3H2,1-2H3,(H,14,15,16,17) |
| InChIKey | TVOKXSQAEWYICY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |