C17H22ClN3OS — CID 15335049
2-[[(1S,5R)-5-[(4-chlorophenyl)methyl]-1-hydroxy-2,2-dimethylcyclopentyl]methyl]-1H-1,2,4-triazole-3-thione (PubChem CID 15335049) has the molecular formula C17H22ClN3OS and a molecular weight of 351.90 g/mol. Its IUPAC name is 2-[[(1S,5R)-5-[(4-chlorophenyl)methyl]-1-hydroxy-2,2-dimethylcyclopentyl]methyl]-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(1S,5R)-5-[(4-chlorophenyl)methyl]-1-hydroxy-2,2-dimethylcyclopentyl]methyl]-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 15335049 |
| Molecular Formula | C17H22ClN3OS |
| Molecular Weight | 351.90 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2-[[(1S,5R)-5-[(4-chlorophenyl)methyl]-1-hydroxy-2,2-dimethylcyclopentyl]methyl]-1H-1,2,4-triazole-3-thione |
| SMILES | CC1(C)CC[C@H](Cc2ccc(Cl)cc2)[C@@]1(O)Cn1[nH]cnc1=S |
| InChI | InChI=1S/C17H22ClN3OS/c1-16(2)8-7-13(9-12-3-5-14(18)6-4-12)17(16,22)10-21-15(23)19-11-20-21/h3-6,11,13,22H,7-10H2,1-2H3,(H,19,20,23)/t13-,17+/m1/s1 |
| InChIKey | PNZFMBJCQLIYNR-DYVFJYSZSA-N |
| XLogP | 4.00 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.90 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|