C28H29NO4 — CID 153350719
methyl 2-[2-[[7-[3-(aminomethyl)phenyl]-2-propyl-1-benzofuran-5-yl]methoxy]phenyl]acetate (PubChem CID 153350719) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is methyl 2-[2-[[7-[3-(aminomethyl)phenyl]-2-propyl-1-benzofuran-5-yl]methoxy]phenyl]acetate.
| Compound Name | methyl 2-[2-[[7-[3-(aminomethyl)phenyl]-2-propyl-1-benzofuran-5-yl]methoxy]phenyl]acetate |
|---|---|
| PubChem CID | 153350719 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | methyl 2-[2-[[7-[3-(aminomethyl)phenyl]-2-propyl-1-benzofuran-5-yl]methoxy]phenyl]acetate |
| SMILES | CCCc1cc2cc(COc3ccccc3CC(=O)OC)cc(-c3cccc(CN)c3)c2o1 |
| InChI | InChI=1S/C28H29NO4/c1-3-7-24-15-23-13-20(18-32-26-11-5-4-9-22(26)16-27(30)31-2)14-25(28(23)33-24)21-10-6-8-19(12-21)17-29/h4-6,8-15H,3,7,16-18,29H2,1-2H3 |
| InChIKey | TWTWORTYKZFBTF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |