C28H40N2O — CID 153351239
[6-(1,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl)-3-amino-4-[(4-ethenylphenyl)iminomethyl]-6-methylcyclohex-3-en-1-yl]methanol (PubChem CID 153351239) has the molecular formula C28H40N2O and a molecular weight of 420.64 g/mol. Its IUPAC name is [6-(1,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl)-3-amino-4-[(4-ethenylphenyl)iminomethyl]-6-methylcyclohex-3-en-1-yl]methanol.
| Compound Name | [6-(1,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl)-3-amino-4-[(4-ethenylphenyl)iminomethyl]-6-methylcyclohex-3-en-1-yl]methanol |
|---|---|
| PubChem CID | 153351239 |
| Molecular Formula | C28H40N2O |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | [6-(1,7a-dimethyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl)-3-amino-4-[(4-ethenylphenyl)iminomethyl]-6-methylcyclohex-3-en-1-yl]methanol |
| SMILES | C=Cc1ccc(/N=C/C2=C(N)CC(CO)C(C)(C3CCC4(C)C(C)CCC4C3)C2)cc1 |
| InChI | InChI=1S/C28H40N2O/c1-5-20-7-10-25(11-8-20)30-17-21-16-28(4,24(18-31)15-26(21)29)23-12-13-27(3)19(2)6-9-22(27)14-23/h5,7-8,10-11,17,19,22-24,31H,1,6,9,12-16,18,29H2,2-4H3/b30-17+ |
| InChIKey | XGCJYTZWMPCBMV-OCSSWDANSA-N |
| XLogP | 6.51 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|