C44H46N6O5S — CID 153351398
N-[1-(3-cyano-9-ethyl-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)piperidin-4-yl]-5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfanyl]pentanamide (PubChem CID 153351398) has the molecular formula C44H46N6O5S and a molecular weight of 770.96 g/mol. Its IUPAC name is N-[1-(3-cyano-9-ethyl-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)piperidin-4-yl]-5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfanyl]pentanamide.
| Compound Name | N-[1-(3-cyano-9-ethyl-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)piperidin-4-yl]-5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfanyl]pentanamide |
|---|---|
| PubChem CID | 153351398 |
| Molecular Formula | C44H46N6O5S |
| Molecular Weight | 770.96 g/mol |
| Exact Mass | 770.33 |
| IUPAC Name | N-[1-(3-cyano-9-ethyl-6,6-dimethyl-11-oxo-5H-benzo[b]carbazol-8-yl)piperidin-4-yl]-5-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfanyl]pentanamide |
| SMILES | CCc1cc2c(cc1N1CCC(NC(=O)CCCCSc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)CC1)C(C)(C)c1[nH]c3cc(C#N)ccc3c1C2=O |
| InChI | InChI=1S/C44H46N6O5S/c1-4-26-21-30-32(44(2,3)41-39(40(30)53)29-12-11-25(23-45)20-33(29)47-41)22-35(26)49-17-15-27(16-18-49)46-37(51)10-5-6-19-56-36-9-7-8-28-31(36)24-50(43(28)55)34-13-14-38(52)48-42(34)54/h7-9,11-12,20-22,27,34,47H,4-6,10,13-19,24H2,1-3H3,(H,46,51)(H,48,52,54) |
| InChIKey | KQGRHLKLKFKAAU-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 155.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.96 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|