C8H10N+ — CID 153352577
3,4-dimethylcyclohexa-2,4-dien-1-imine (PubChem CID 153352577) has the molecular formula C8H10N+ and a molecular weight of 120.17 g/mol. Its IUPAC name is 3,4-dimethylcyclohexa-2,4-dien-1-imine.
| Compound Name | 3,4-dimethylcyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 153352577 |
| Molecular Formula | C8H10N+ |
| Molecular Weight | 120.17 g/mol |
| Exact Mass | 120.08 |
| IUPAC Name | 3,4-dimethylcyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=C(C)C(C)=C[CH+]1 |
| InChI | InChI=1S/C8H10N/c1-6-3-4-8(9)5-7(6)2/h3-5,9H,1-2H3/q+1/b9-8- |
| InChIKey | FOYRAEUZQDZPLR-HJWRWDBZSA-N |
| XLogP | 2.12 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.17 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|