ethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate

C18H27NO3 — CID 153352723

IUPACethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate
SMILESCC.CCOC(=O)C(CC(C)C)N1Cc2ccccc2C1=O
InChIInChI=1S/C16H21NO3.C2H6/c1-4-20-16(19)14(9-11(2)3)17-10-12-7-5-6-8-13(12)15(17)18;1-2/h5-8,11,14H,4,9-10H2,1-3H3;1-2H3
InChIKeyVPATYKLKAKPARM-UHFFFAOYSA-N
MW305.42 g/mol
LogP3.65
Rot. Bonds5

About ethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate

ethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate (PubChem CID 153352723) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is ethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate.

Molecular Properties

Compound Nameethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate
PubChem CID153352723
Molecular FormulaC18H27NO3
Molecular Weight305.42 g/mol
Exact Mass305.20
IUPAC Nameethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate
SMILESCC.CCOC(=O)C(CC(C)C)N1Cc2ccccc2C1=O
InChIInChI=1S/C16H21NO3.C2H6/c1-4-20-16(19)14(9-11(2)3)17-10-12-7-5-6-8-13(12)15(17)18;1-2/h5-8,11,14H,4,9-10H2,1-3H3;1-2H3
InChIKeyVPATYKLKAKPARM-UHFFFAOYSA-N
XLogP3.65
TPSA46.61 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.42
LogP ≤ 53.65
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze ethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate?
The IUPAC name of ethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate (CID 153352723) is ethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate.
What is the SMILES notation for ethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate?
The canonical SMILES for ethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate is CC.CCOC(=O)C(CC(C)C)N1Cc2ccccc2C1=O.
What is the InChIKey of ethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate?
The InChIKey is VPATYKLKAKPARM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO3.C2H6/c1-4-20-16(19)14(9-11(2)3)17-10-12-7-5-6-8-13(12)15(17)18;1-2/h5-8,11,14H,4,9-10H2,1-3H3;1-2H3.
What are the key properties of ethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate?
ethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate has a molecular weight of 305.42 g/mol, XLogP of 3.65, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate is sourced from PubChem (CID 153352723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).