C18H27NO3 — CID 153352723
ethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate (PubChem CID 153352723) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is ethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate.
| Compound Name | ethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate |
|---|---|
| PubChem CID | 153352723 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | ethane;ethyl 4-methyl-2-(3-oxo-1H-isoindol-2-yl)pentanoate |
| SMILES | CC.CCOC(=O)C(CC(C)C)N1Cc2ccccc2C1=O |
| InChI | InChI=1S/C16H21NO3.C2H6/c1-4-20-16(19)14(9-11(2)3)17-10-12-7-5-6-8-13(12)15(17)18;1-2/h5-8,11,14H,4,9-10H2,1-3H3;1-2H3 |
| InChIKey | VPATYKLKAKPARM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |