C10H17FN2 — CID 153352847
(Z,3Z)-N'-fluoro-N,N'-dimethyl-3-prop-2-enylidenepent-1-ene-1,5-diamine (PubChem CID 153352847) has the molecular formula C10H17FN2 and a molecular weight of 184.26 g/mol. Its IUPAC name is (Z,3Z)-N'-fluoro-N,N'-dimethyl-3-prop-2-enylidenepent-1-ene-1,5-diamine.
| Compound Name | (Z,3Z)-N'-fluoro-N,N'-dimethyl-3-prop-2-enylidenepent-1-ene-1,5-diamine |
|---|---|
| PubChem CID | 153352847 |
| Molecular Formula | C10H17FN2 |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.14 |
| IUPAC Name | (Z,3Z)-N'-fluoro-N,N'-dimethyl-3-prop-2-enylidenepent-1-ene-1,5-diamine |
| SMILES | C=C/C=C(\C=C/NC)CCN(C)F |
| InChI | InChI=1S/C10H17FN2/c1-4-5-10(6-8-12-2)7-9-13(3)11/h4-6,8,12H,1,7,9H2,2-3H3/b8-6-,10-5+ |
| InChIKey | SAPKCAWIEYPJIJ-LTFLHPNNSA-N |
| XLogP | 2.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|