About ethane;1-methyl-5-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]pyridin-2-one
ethane;1-methyl-5-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]pyridin-2-one (PubChem CID 153352874) has the molecular formula C14H20N2O
and a molecular weight of 232.33 g/mol. Its IUPAC name is ethane;1-methyl-5-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]pyridin-2-one.
Molecular Properties
| Compound Name | ethane;1-methyl-5-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]pyridin-2-one |
| PubChem CID | 153352874 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | ethane;1-methyl-5-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]pyridin-2-one |
| SMILES | C=N/C(=C\C=C/C)c1ccc(=O)n(C)c1.CC |
| InChI | InChI=1S/C12H14N2O.C2H6/c1-4-5-6-11(13-2)10-7-8-12(15)14(3)9-10;1-2/h4-9H,2H2,1,3H3;1-2H3/b5-4-,11-6-; |
| InChIKey | IBONBDHAQMXIJZ-XXAFYWQYSA-N |
| XLogP | 3.03 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-methyl-5-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-5-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]pyridin-2-one?
The IUPAC name of ethane;1-methyl-5-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]pyridin-2-one (CID 153352874) is ethane;1-methyl-5-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]pyridin-2-one.
What is the SMILES notation for ethane;1-methyl-5-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]pyridin-2-one?
The canonical SMILES for ethane;1-methyl-5-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]pyridin-2-one is C=N/C(=C\C=C/C)c1ccc(=O)n(C)c1.CC.
What is the InChIKey of ethane;1-methyl-5-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]pyridin-2-one?
The InChIKey is IBONBDHAQMXIJZ-XXAFYWQYSA-N. The full InChI is InChI=1S/C12H14N2O.C2H6/c1-4-5-6-11(13-2)10-7-8-12(15)14(3)9-10;1-2/h4-9H,2H2,1,3H3;1-2H3/b5-4-,11-6-;.
What are the key properties of ethane;1-methyl-5-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]pyridin-2-one?
ethane;1-methyl-5-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]pyridin-2-one has a molecular weight of 232.33 g/mol, XLogP of 3.03, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-5-[(1Z,3Z)-1-(methylideneamino)penta-1,3-dienyl]pyridin-2-one is sourced from PubChem (CID 153352874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).