C36H30N4O2 — CID 153352960
2-[1-(1H-indol-3-yl)ethyl]-1H-indole-3-carboxylic acid;2-(1H-indol-3-ylmethyl)-1H-indole (PubChem CID 153352960) has the molecular formula C36H30N4O2 and a molecular weight of 550.66 g/mol. Its IUPAC name is 2-[1-(1H-indol-3-yl)ethyl]-1H-indole-3-carboxylic acid;2-(1H-indol-3-ylmethyl)-1H-indole.
| Compound Name | 2-[1-(1H-indol-3-yl)ethyl]-1H-indole-3-carboxylic acid;2-(1H-indol-3-ylmethyl)-1H-indole |
|---|---|
| PubChem CID | 153352960 |
| Molecular Formula | C36H30N4O2 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 2-[1-(1H-indol-3-yl)ethyl]-1H-indole-3-carboxylic acid;2-(1H-indol-3-ylmethyl)-1H-indole |
| SMILES | CC(c1[nH]c2ccccc2c1C(=O)O)c1c[nH]c2ccccc12.c1ccc2[nH]c(Cc3c[nH]c4ccccc34)cc2c1 |
| InChI | InChI=1S/C19H16N2O2.C17H14N2/c1-11(14-10-20-15-8-4-2-6-12(14)15)18-17(19(22)23)13-7-3-5-9-16(13)21-18;1-3-7-16-12(5-1)9-14(19-16)10-13-11-18-17-8-4-2-6-15(13)17/h2-11,20-21H,1H3,(H,22,23);1-9,11,18-19H,10H2 |
| InChIKey | RVGFSLRBQYRAQG-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 1 |