C38H31N3O4 — CID 153352965
2-[1-(1-benzofuran-3-yl)ethyl]-1H-indole-3-carbaldehyde;2-[1H-indol-3-yl(methoxy)methyl]-1H-indole-3-carbaldehyde (PubChem CID 153352965) has the molecular formula C38H31N3O4 and a molecular weight of 593.68 g/mol. Its IUPAC name is 2-[1-(1-benzofuran-3-yl)ethyl]-1H-indole-3-carbaldehyde;2-[1H-indol-3-yl(methoxy)methyl]-1H-indole-3-carbaldehyde.
| Compound Name | 2-[1-(1-benzofuran-3-yl)ethyl]-1H-indole-3-carbaldehyde;2-[1H-indol-3-yl(methoxy)methyl]-1H-indole-3-carbaldehyde |
|---|---|
| PubChem CID | 153352965 |
| Molecular Formula | C38H31N3O4 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | 2-[1-(1-benzofuran-3-yl)ethyl]-1H-indole-3-carbaldehyde;2-[1H-indol-3-yl(methoxy)methyl]-1H-indole-3-carbaldehyde |
| SMILES | CC(c1[nH]c2ccccc2c1C=O)c1coc2ccccc12.COC(c1[nH]c2ccccc2c1C=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H16N2O2.C19H15NO2/c1-23-19(14-10-20-16-8-4-2-6-12(14)16)18-15(11-22)13-7-3-5-9-17(13)21-18;1-12(16-11-22-18-9-5-3-7-14(16)18)19-15(10-21)13-6-2-4-8-17(13)20-19/h2-11,19-21H,1H3;2-12,20H,1H3 |
| InChIKey | IGQUUNSLDGXDAP-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|