C40H31N3O4 — CID 153352968
[2-[1-(1-benzofuran-3-yl)ethyl]-3-formylindol-1-yl] 2-[cyclopropyl(1H-indol-3-yl)methyl]-1H-indole-3-carboxylate (PubChem CID 153352968) has the molecular formula C40H31N3O4 and a molecular weight of 617.71 g/mol. Its IUPAC name is [2-[1-(1-benzofuran-3-yl)ethyl]-3-formylindol-1-yl] 2-[cyclopropyl(1H-indol-3-yl)methyl]-1H-indole-3-carboxylate.
| Compound Name | [2-[1-(1-benzofuran-3-yl)ethyl]-3-formylindol-1-yl] 2-[cyclopropyl(1H-indol-3-yl)methyl]-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 153352968 |
| Molecular Formula | C40H31N3O4 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | [2-[1-(1-benzofuran-3-yl)ethyl]-3-formylindol-1-yl] 2-[cyclopropyl(1H-indol-3-yl)methyl]-1H-indole-3-carboxylate |
| SMILES | CC(c1coc2ccccc12)c1c(C=O)c2ccccc2n1OC(=O)c1c(C(c2c[nH]c3ccccc23)C2CC2)[nH]c2ccccc12 |
| InChI | InChI=1S/C40H31N3O4/c1-23(31-22-46-35-17-9-5-12-27(31)35)39-30(21-44)26-11-4-8-16-34(26)43(39)47-40(45)37-28-13-3-7-15-33(28)42-38(37)36(24-18-19-24)29-20-41-32-14-6-2-10-25(29)32/h2-17,20-24,36,41-42H,18-19H2,1H3 |
| InChIKey | FUVQXBHMCXGBKF-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|