About 6-chloro-1-methylindole
6-chloro-1-methylindole (PubChem CID 15335321) has the molecular formula C9H8ClN
and a molecular weight of 165.62 g/mol. Its IUPAC name is 6-chloro-1-methylindole.
Molecular Properties
| Compound Name | 6-chloro-1-methylindole |
| PubChem CID | 15335321 |
| Molecular Formula | C9H8ClN |
| Molecular Weight | 165.62 g/mol |
| Exact Mass | 165.03 |
| IUPAC Name | 6-chloro-1-methylindole |
| SMILES | Cn1ccc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H8ClN/c1-11-5-4-7-2-3-8(10)6-9(7)11/h2-6H,1H3 |
| InChIKey | YDLOPHRVGMIZDX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.62 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-chloro-1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1-methylindole?
The IUPAC name of 6-chloro-1-methylindole (CID 15335321) is 6-chloro-1-methylindole.
What is the SMILES notation for 6-chloro-1-methylindole?
The canonical SMILES for 6-chloro-1-methylindole is Cn1ccc2ccc(Cl)cc21.
What is the InChIKey of 6-chloro-1-methylindole?
The InChIKey is YDLOPHRVGMIZDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClN/c1-11-5-4-7-2-3-8(10)6-9(7)11/h2-6H,1H3.
What are the key properties of 6-chloro-1-methylindole?
6-chloro-1-methylindole has a molecular weight of 165.62 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1-methylindole is sourced from PubChem (CID 15335321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).