C18H19BN6O — CID 153353385
CID 153353385 (PubChem CID 153353385) has the molecular formula C18H19BN6O and a molecular weight of 346.20 g/mol.
| Compound Name | CID 153353385 |
|---|---|
| PubChem CID | 153353385 |
| Molecular Formula | C18H19BN6O |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(CNc2nc(C)nc3cnc(N4CCOCC4)nc23)c1 |
| InChI | InChI=1S/C18H19BN6O/c1-12-22-15-11-21-18(25-5-7-26-8-6-25)24-16(15)17(23-12)20-10-13-3-2-4-14(19)9-13/h2-4,9,11H,5-8,10H2,1H3,(H,20,22,23) |
| InChIKey | QQDYHNJVYYTTTQ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 76.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|