About 2,3-dihydro-1-benzofuran-4,6-diol;ethane
2,3-dihydro-1-benzofuran-4,6-diol;ethane (PubChem CID 153353462) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-4,6-diol;ethane.
Molecular Properties
| Compound Name | 2,3-dihydro-1-benzofuran-4,6-diol;ethane |
| PubChem CID | 153353462 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-4,6-diol;ethane |
| SMILES | CC.Oc1cc(O)c2c(c1)OCC2 |
| InChI | InChI=1S/C8H8O3.C2H6/c9-5-3-7(10)6-1-2-11-8(6)4-5;1-2/h3-4,9-10H,1-2H2;1-2H3 |
| InChIKey | LAJRRJMDKINVAF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-1-benzofuran-4,6-diol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1-benzofuran-4,6-diol;ethane?
The IUPAC name of 2,3-dihydro-1-benzofuran-4,6-diol;ethane (CID 153353462) is 2,3-dihydro-1-benzofuran-4,6-diol;ethane.
What is the SMILES notation for 2,3-dihydro-1-benzofuran-4,6-diol;ethane?
The canonical SMILES for 2,3-dihydro-1-benzofuran-4,6-diol;ethane is CC.Oc1cc(O)c2c(c1)OCC2.
What is the InChIKey of 2,3-dihydro-1-benzofuran-4,6-diol;ethane?
The InChIKey is LAJRRJMDKINVAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.C2H6/c9-5-3-7(10)6-1-2-11-8(6)4-5;1-2/h3-4,9-10H,1-2H2;1-2H3.
What are the key properties of 2,3-dihydro-1-benzofuran-4,6-diol;ethane?
2,3-dihydro-1-benzofuran-4,6-diol;ethane has a molecular weight of 182.22 g/mol, XLogP of 2.06, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1-benzofuran-4,6-diol;ethane is sourced from PubChem (CID 153353462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).