C10H5Cl3F3NO2S — CID 15335372
5,6-dichloro-2-(2-chloro-1,1,2-trifluoroethyl)sulfonyl-1H-indole (PubChem CID 15335372) has the molecular formula C10H5Cl3F3NO2S and a molecular weight of 366.58 g/mol. Its IUPAC name is 5,6-dichloro-2-(2-chloro-1,1,2-trifluoroethyl)sulfonyl-1H-indole.
| Compound Name | 5,6-dichloro-2-(2-chloro-1,1,2-trifluoroethyl)sulfonyl-1H-indole |
|---|---|
| PubChem CID | 15335372 |
| Molecular Formula | C10H5Cl3F3NO2S |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 364.91 |
| IUPAC Name | 5,6-dichloro-2-(2-chloro-1,1,2-trifluoroethyl)sulfonyl-1H-indole |
| SMILES | O=S(=O)(c1cc2cc(Cl)c(Cl)cc2[nH]1)C(F)(F)C(F)Cl |
| InChI | InChI=1S/C10H5Cl3F3NO2S/c11-5-1-4-2-8(17-7(4)3-6(5)12)20(18,19)10(15,16)9(13)14/h1-3,9,17H |
| InChIKey | CGJDIAMKQYMNGI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|