C9H12FNO2S — CID 153354066
[4,5-dihydroxy-2-[2-(methylamino)ethyl]phenyl] thiohypofluorite (PubChem CID 153354066) has the molecular formula C9H12FNO2S and a molecular weight of 217.26 g/mol. Its IUPAC name is [4,5-dihydroxy-2-[2-(methylamino)ethyl]phenyl] thiohypofluorite.
| Compound Name | [4,5-dihydroxy-2-[2-(methylamino)ethyl]phenyl] thiohypofluorite |
|---|---|
| PubChem CID | 153354066 |
| Molecular Formula | C9H12FNO2S |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | [4,5-dihydroxy-2-[2-(methylamino)ethyl]phenyl] thiohypofluorite |
| SMILES | CNCCc1cc(O)c(O)cc1SF |
| InChI | InChI=1S/C9H12FNO2S/c1-11-3-2-6-4-7(12)8(13)5-9(6)14-10/h4-5,11-13H,2-3H2,1H3 |
| InChIKey | BFLOHMMEHLCJBC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|