C34H35FN4O3Si — CID 153354405
CID 153354405 (PubChem CID 153354405) has the molecular formula C34H35FN4O3Si and a molecular weight of 594.76 g/mol.
| Compound Name | CID 153354405 |
|---|---|
| PubChem CID | 153354405 |
| Molecular Formula | C34H35FN4O3Si |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | — |
| SMILES | COC(=O)C[Si]C1CCN(c2ccc(-c3cc4cc(C(=O)N5CCc6ccccc6[C@H]5C)cc(C5CC5)n4n3)c(F)c2)C1 |
| InChI | InChI=1S/C34H35FN4O3Si/c1-21-28-6-4-3-5-22(28)11-14-38(21)34(41)24-15-26-18-31(36-39(26)32(16-24)23-7-8-23)29-10-9-25(17-30(29)35)37-13-12-27(19-37)43-20-33(40)42-2/h3-6,9-10,15-18,21,23,27H,7-8,11-14,19-20H2,1-2H3/t21-,27?/m1/s1 |
| InChIKey | GSERUVQACCTGLH-XJQHNOHDSA-N |
| XLogP | 6.07 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|