C26H35N3O — CID 153354508
4-[(E,4S,5Z)-3-acetyl-2-amino-6-imino-5-[(Z)-3-methylpent-3-en-2-ylidene]dec-2-en-4-yl]-3-methylbenzonitrile (PubChem CID 153354508) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is 4-[(E,4S,5Z)-3-acetyl-2-amino-6-imino-5-[(Z)-3-methylpent-3-en-2-ylidene]dec-2-en-4-yl]-3-methylbenzonitrile.
| Compound Name | 4-[(E,4S,5Z)-3-acetyl-2-amino-6-imino-5-[(Z)-3-methylpent-3-en-2-ylidene]dec-2-en-4-yl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 153354508 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | 4-[(E,4S,5Z)-3-acetyl-2-amino-6-imino-5-[(Z)-3-methylpent-3-en-2-ylidene]dec-2-en-4-yl]-3-methylbenzonitrile |
| SMILES | [H]/N=C(CCCC)/C(=C(C)\C(C)=C/C)[C@@H](/C(C(C)=O)=C(/C)N)c1ccc(C#N)cc1C |
| InChI | InChI=1S/C26H35N3O/c1-8-10-11-23(29)24(18(5)16(3)9-2)26(25(19(6)28)20(7)30)22-13-12-21(15-27)14-17(22)4/h9,12-14,26,29H,8,10-11,28H2,1-7H3/b16-9-,24-18+,25-19-,29-23+/t26-/m0/s1 |
| InChIKey | JZMXWQWSNBLCIZ-HPLRCKICSA-N |
| XLogP | 6.26 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|