C12H24N4O2 — CID 153354640
(2S)-N-(2-amino-2-oxoethyl)-5-[[(Z)-but-2-en-2-yl]amino]-2-(methylamino)pentanamide (PubChem CID 153354640) has the molecular formula C12H24N4O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is (2S)-N-(2-amino-2-oxoethyl)-5-[[(Z)-but-2-en-2-yl]amino]-2-(methylamino)pentanamide.
| Compound Name | (2S)-N-(2-amino-2-oxoethyl)-5-[[(Z)-but-2-en-2-yl]amino]-2-(methylamino)pentanamide |
|---|---|
| PubChem CID | 153354640 |
| Molecular Formula | C12H24N4O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (2S)-N-(2-amino-2-oxoethyl)-5-[[(Z)-but-2-en-2-yl]amino]-2-(methylamino)pentanamide |
| SMILES | C/C=C(/C)NCCC[C@H](NC)C(=O)NCC(N)=O |
| InChI | InChI=1S/C12H24N4O2/c1-4-9(2)15-7-5-6-10(14-3)12(18)16-8-11(13)17/h4,10,14-15H,5-8H2,1-3H3,(H2,13,17)(H,16,18)/b9-4-/t10-/m0/s1 |
| InChIKey | PBTXUIYGPSVTDD-FWAPLPHYSA-N |
| XLogP | -0.53 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|