About [(3S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]pyrrolidin-3-yl]oxy thiohypoiodite
[(3S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]pyrrolidin-3-yl]oxy thiohypoiodite (PubChem CID 153355467) has the molecular formula C12H18INOS
and a molecular weight of 351.25 g/mol. Its IUPAC name is [(3S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]pyrrolidin-3-yl]oxy thiohypoiodite.
Molecular Properties
| Compound Name | [(3S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]pyrrolidin-3-yl]oxy thiohypoiodite |
| PubChem CID | 153355467 |
| Molecular Formula | C12H18INOS |
| Molecular Weight | 351.25 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | [(3S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]pyrrolidin-3-yl]oxy thiohypoiodite |
| SMILES | C=C/C=C\C(=C/C)CN1CC[C@H](OSI)C1 |
| InChI | InChI=1S/C12H18INOS/c1-3-5-6-11(4-2)9-14-8-7-12(10-14)15-16-13/h3-6,12H,1,7-10H2,2H3/b6-5-,11-4+/t12-/m0/s1 |
| InChIKey | OBQPNHQQQTVOAN-FHDIAEEMSA-N |
| XLogP | 3.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]pyrrolidin-3-yl]oxy thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]pyrrolidin-3-yl]oxy thiohypoiodite?
The IUPAC name of [(3S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]pyrrolidin-3-yl]oxy thiohypoiodite (CID 153355467) is [(3S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]pyrrolidin-3-yl]oxy thiohypoiodite.
What is the SMILES notation for [(3S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]pyrrolidin-3-yl]oxy thiohypoiodite?
The canonical SMILES for [(3S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]pyrrolidin-3-yl]oxy thiohypoiodite is C=C/C=C\C(=C/C)CN1CC[C@H](OSI)C1.
What is the InChIKey of [(3S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]pyrrolidin-3-yl]oxy thiohypoiodite?
The InChIKey is OBQPNHQQQTVOAN-FHDIAEEMSA-N. The full InChI is InChI=1S/C12H18INOS/c1-3-5-6-11(4-2)9-14-8-7-12(10-14)15-16-13/h3-6,12H,1,7-10H2,2H3/b6-5-,11-4+/t12-/m0/s1.
What are the key properties of [(3S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]pyrrolidin-3-yl]oxy thiohypoiodite?
[(3S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]pyrrolidin-3-yl]oxy thiohypoiodite has a molecular weight of 351.25 g/mol, XLogP of 3.76, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]pyrrolidin-3-yl]oxy thiohypoiodite is sourced from PubChem (CID 153355467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).