C21H25F3N7O2+ — CID 153355512
methylidene-[(7S)-4,5,7,8-tetramethyl-6-oxo-7H-pteridin-2-yl]-[3-[[2-(trifluoromethyl)pyrimidin-5-yl]oxymethyl]cyclobutyl]azanium (PubChem CID 153355512) has the molecular formula C21H25F3N7O2+ and a molecular weight of 464.47 g/mol. Its IUPAC name is methylidene-[(7S)-4,5,7,8-tetramethyl-6-oxo-7H-pteridin-2-yl]-[3-[[2-(trifluoromethyl)pyrimidin-5-yl]oxymethyl]cyclobutyl]azanium.
| Compound Name | methylidene-[(7S)-4,5,7,8-tetramethyl-6-oxo-7H-pteridin-2-yl]-[3-[[2-(trifluoromethyl)pyrimidin-5-yl]oxymethyl]cyclobutyl]azanium |
|---|---|
| PubChem CID | 153355512 |
| Molecular Formula | C21H25F3N7O2+ |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | methylidene-[(7S)-4,5,7,8-tetramethyl-6-oxo-7H-pteridin-2-yl]-[3-[[2-(trifluoromethyl)pyrimidin-5-yl]oxymethyl]cyclobutyl]azanium |
| SMILES | C=[N+](c1nc(C)c2c(n1)N(C)[C@@H](C)C(=O)N2C)C1CC(COc2cnc(C(F)(F)F)nc2)C1 |
| InChI | InChI=1S/C21H25F3N7O2/c1-11-16-17(29(3)12(2)18(32)31(16)5)28-20(27-11)30(4)14-6-13(7-14)10-33-15-8-25-19(26-9-15)21(22,23)24/h8-9,12-14H,4,6-7,10H2,1-3,5H3/q+1/t12-,13?,14?/m0/s1 |
| InChIKey | CVCICQGFABYVKY-HSBZDZAISA-N |
| XLogP | 2.60 |
| TPSA | 87.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|