C10H17NO — CID 153355576
(2E,4E)-5-(3-aminocyclobutyl)hexa-2,4-dien-2-ol (PubChem CID 153355576) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (2E,4E)-5-(3-aminocyclobutyl)hexa-2,4-dien-2-ol.
| Compound Name | (2E,4E)-5-(3-aminocyclobutyl)hexa-2,4-dien-2-ol |
|---|---|
| PubChem CID | 153355576 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (2E,4E)-5-(3-aminocyclobutyl)hexa-2,4-dien-2-ol |
| SMILES | C/C(O)=C\C=C(/C)C1CC(N)C1 |
| InChI | InChI=1S/C10H17NO/c1-7(3-4-8(2)12)9-5-10(11)6-9/h3-4,9-10,12H,5-6,11H2,1-2H3/b7-3+,8-4+ |
| InChIKey | VFFDPLBIUBRHQI-FCXRPNKRSA-N |
| XLogP | 2.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|