C22H31N7OS — CID 153356731
N-[[5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1H-1,2,4-triazol-3-yl]oxysulfanyl]-N,5-dimethyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-amine (PubChem CID 153356731) has the molecular formula C22H31N7OS and a molecular weight of 441.61 g/mol. Its IUPAC name is N-[[5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1H-1,2,4-triazol-3-yl]oxysulfanyl]-N,5-dimethyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-amine.
| Compound Name | N-[[5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1H-1,2,4-triazol-3-yl]oxysulfanyl]-N,5-dimethyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-amine |
|---|---|
| PubChem CID | 153356731 |
| Molecular Formula | C22H31N7OS |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | N-[[5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1H-1,2,4-triazol-3-yl]oxysulfanyl]-N,5-dimethyl-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-amine |
| SMILES | CN1CC2CCN(N(C)SOc3n[nH]c(Nc4c5c(cc6c4CCC6)CCC5)n3)C2C1 |
| InChI | InChI=1S/C22H31N7OS/c1-27-12-16-9-10-29(19(16)13-27)28(2)31-30-22-24-21(25-26-22)23-20-17-7-3-5-14(17)11-15-6-4-8-18(15)20/h11,16,19H,3-10,12-13H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | QHJXTNVBBCFAQU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|