C25H34N6S — CID 153357315
3-[(2-cyclopropyl-2,8-diazaspiro[4.5]decan-8-yl)sulfanyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1H-1,2,4-triazol-5-amine (PubChem CID 153357315) has the molecular formula C25H34N6S and a molecular weight of 450.66 g/mol. Its IUPAC name is 3-[(2-cyclopropyl-2,8-diazaspiro[4.5]decan-8-yl)sulfanyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1H-1,2,4-triazol-5-amine.
| Compound Name | 3-[(2-cyclopropyl-2,8-diazaspiro[4.5]decan-8-yl)sulfanyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 153357315 |
| Molecular Formula | C25H34N6S |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 3-[(2-cyclopropyl-2,8-diazaspiro[4.5]decan-8-yl)sulfanyl]-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-1H-1,2,4-triazol-5-amine |
| SMILES | c1c2c(c(Nc3nc(SN4CCC5(CC4)CCN(C4CC4)C5)n[nH]3)c3c1CCC3)CCC2 |
| InChI | InChI=1S/C25H34N6S/c1-3-17-15-18-4-2-6-21(18)22(20(17)5-1)26-23-27-24(29-28-23)32-31-13-10-25(11-14-31)9-12-30(16-25)19-7-8-19/h15,19H,1-14,16H2,(H2,26,27,28,29) |
| InChIKey | UHGFVDSCHGHIHO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|