C22H27F3N6S — CID 153357341
N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[7-(2,2,2-trifluoroethyl)-2,7-diazaspiro[3.4]octan-2-yl]sulfanyl]-1H-1,2,4-triazol-5-amine (PubChem CID 153357341) has the molecular formula C22H27F3N6S and a molecular weight of 464.56 g/mol. Its IUPAC name is N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[7-(2,2,2-trifluoroethyl)-2,7-diazaspiro[3.4]octan-2-yl]sulfanyl]-1H-1,2,4-triazol-5-amine.
| Compound Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[7-(2,2,2-trifluoroethyl)-2,7-diazaspiro[3.4]octan-2-yl]sulfanyl]-1H-1,2,4-triazol-5-amine |
|---|---|
| PubChem CID | 153357341 |
| Molecular Formula | C22H27F3N6S |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[7-(2,2,2-trifluoroethyl)-2,7-diazaspiro[3.4]octan-2-yl]sulfanyl]-1H-1,2,4-triazol-5-amine |
| SMILES | FC(F)(F)CN1CCC2(C1)CN(Sc1n[nH]c(Nc3c4c(cc5c3CCC5)CCC4)n1)C2 |
| InChI | InChI=1S/C22H27F3N6S/c23-22(24,25)13-30-8-7-21(10-30)11-31(12-21)32-20-27-19(28-29-20)26-18-16-5-1-3-14(16)9-15-4-2-6-17(15)18/h9H,1-8,10-13H2,(H2,26,27,28,29) |
| InChIKey | WOYHUFVJBPRGBB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|