C21H27N3O4 — CID 153357476
[(1R,2R)-2-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyrrolidin-1-ylpropoxy]-pyridin-3-ylmethanol (PubChem CID 153357476) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is [(1R,2R)-2-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyrrolidin-1-ylpropoxy]-pyridin-3-ylmethanol.
| Compound Name | [(1R,2R)-2-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyrrolidin-1-ylpropoxy]-pyridin-3-ylmethanol |
|---|---|
| PubChem CID | 153357476 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | [(1R,2R)-2-amino-1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-pyrrolidin-1-ylpropoxy]-pyridin-3-ylmethanol |
| SMILES | N[C@H](CN1CCCC1)[C@H](OC(O)c1cccnc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H27N3O4/c22-17(14-24-8-1-2-9-24)20(28-21(25)16-4-3-7-23-13-16)15-5-6-18-19(12-15)27-11-10-26-18/h3-7,12-13,17,20-21,25H,1-2,8-11,14,22H2/t17-,20-,21?/m1/s1 |
| InChIKey | WNCOLSDYKZGCFH-WUQHVDQBSA-N |
| XLogP | 2.02 |
| TPSA | 90.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|