About 2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol;hydrochloride
2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol;hydrochloride (PubChem CID 153357652) has the molecular formula C14H29ClN4O2
and a molecular weight of 320.87 g/mol. Its IUPAC name is 2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol;hydrochloride |
| PubChem CID | 153357652 |
| Molecular Formula | C14H29ClN4O2 |
| Molecular Weight | 320.87 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol;hydrochloride |
| SMILES | CCCCCCCCCn1cc(C(N)(CO)CO)nn1.Cl |
| InChI | InChI=1S/C14H28N4O2.ClH/c1-2-3-4-5-6-7-8-9-18-10-13(16-17-18)14(15,11-19)12-20;/h10,19-20H,2-9,11-12,15H2,1H3;1H |
| InChIKey | HOTAZHVFANOVID-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.87 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol;hydrochloride?
The IUPAC name of 2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol;hydrochloride (CID 153357652) is 2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol;hydrochloride.
What is the SMILES notation for 2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol;hydrochloride?
The canonical SMILES for 2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol;hydrochloride is CCCCCCCCCn1cc(C(N)(CO)CO)nn1.Cl.
What is the InChIKey of 2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol;hydrochloride?
The InChIKey is HOTAZHVFANOVID-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N4O2.ClH/c1-2-3-4-5-6-7-8-9-18-10-13(16-17-18)14(15,11-19)12-20;/h10,19-20H,2-9,11-12,15H2,1H3;1H.
What are the key properties of 2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol;hydrochloride?
2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol;hydrochloride has a molecular weight of 320.87 g/mol, XLogP of 1.59, 11 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(1-nonyltriazol-4-yl)propane-1,3-diol;hydrochloride is sourced from PubChem (CID 153357652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).