C31H38N4 — CID 15335798
7,8,12,13-tetraethyl-2,3,17,18-tetramethyl-22,23-dihydro-21H-corrin (PubChem CID 15335798) has the molecular formula C31H38N4 and a molecular weight of 466.67 g/mol. Its IUPAC name is 7,8,12,13-tetraethyl-2,3,17,18-tetramethyl-22,23-dihydro-21H-corrin.
| Compound Name | 7,8,12,13-tetraethyl-2,3,17,18-tetramethyl-22,23-dihydro-21H-corrin |
|---|---|
| PubChem CID | 15335798 |
| Molecular Formula | C31H38N4 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | 7,8,12,13-tetraethyl-2,3,17,18-tetramethyl-22,23-dihydro-21H-corrin |
| SMILES | CCc1c(CC)c2cc3[nH]c(cc4[nH]c(c5nc(cc1[nH]2)C(C)=C5C)c(C)c4C)c(CC)c3CC |
| InChI | InChI=1S/C31H38N4/c1-9-20-22(11-3)28-15-29-23(12-4)21(10-2)27(33-29)14-25-17(6)19(8)31(35-25)30-18(7)16(5)24(34-30)13-26(20)32-28/h13-15,32-34H,9-12H2,1-8H3/b24-13-,25-14-,26-13-,27-14-,28-15-,29-15-,31-30- |
| InChIKey | PHKFOFHESXQFMV-GOGJFRSNSA-N |
| XLogP | 8.34 |
| TPSA | 60.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |