C9H10F3N3O — CID 153358084
4-pyrrolidin-1-yl-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 153358084) has the molecular formula C9H10F3N3O and a molecular weight of 233.19 g/mol. Its IUPAC name is 4-pyrrolidin-1-yl-5-(trifluoromethyl)-1H-pyridazin-6-one.
| Compound Name | 4-pyrrolidin-1-yl-5-(trifluoromethyl)-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 153358084 |
| Molecular Formula | C9H10F3N3O |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 4-pyrrolidin-1-yl-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(N2CCCC2)c1C(F)(F)F |
| InChI | InChI=1S/C9H10F3N3O/c10-9(11,12)7-6(5-13-14-8(7)16)15-3-1-2-4-15/h5H,1-4H2,(H,14,16) |
| InChIKey | MGTIJNNNQMOVKB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |