C23H34ClN3O3 — CID 153358275
5-chloro-4-(4-propoxy-1,3-dihydroisoindol-2-yl)-1H-pyridazin-6-one;3-methyl-1-propoxybutane (PubChem CID 153358275) has the molecular formula C23H34ClN3O3 and a molecular weight of 436.00 g/mol. Its IUPAC name is 5-chloro-4-(4-propoxy-1,3-dihydroisoindol-2-yl)-1H-pyridazin-6-one;3-methyl-1-propoxybutane.
| Compound Name | 5-chloro-4-(4-propoxy-1,3-dihydroisoindol-2-yl)-1H-pyridazin-6-one;3-methyl-1-propoxybutane |
|---|---|
| PubChem CID | 153358275 |
| Molecular Formula | C23H34ClN3O3 |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 5-chloro-4-(4-propoxy-1,3-dihydroisoindol-2-yl)-1H-pyridazin-6-one;3-methyl-1-propoxybutane |
| SMILES | CCCOCCC(C)C.CCCOc1cccc2c1CN(c1cn[nH]c(=O)c1Cl)C2 |
| InChI | InChI=1S/C15H16ClN3O2.C8H18O/c1-2-6-21-13-5-3-4-10-8-19(9-11(10)13)12-7-17-18-15(20)14(12)16;1-4-6-9-7-5-8(2)3/h3-5,7H,2,6,8-9H2,1H3,(H,18,20);8H,4-7H2,1-3H3 |
| InChIKey | YRALWCUAUWMHSG-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|