About potassium;carbanide;5,8-dihydropyrimido[5,4-b]indol-8-id-4-amine
potassium;carbanide;5,8-dihydropyrimido[5,4-b]indol-8-id-4-amine (PubChem CID 153358363) has the molecular formula C11H10KN4-
and a molecular weight of 237.33 g/mol. Its IUPAC name is potassium;carbanide;5,8-dihydropyrimido[5,4-b]indol-8-id-4-amine.
Molecular Properties
| Compound Name | potassium;carbanide;5,8-dihydropyrimido[5,4-b]indol-8-id-4-amine |
| PubChem CID | 153358363 |
| Molecular Formula | C11H10KN4- |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | potassium;carbanide;5,8-dihydropyrimido[5,4-b]indol-8-id-4-amine |
| SMILES | Nc1ncnc2c1[nH]c1cc[c-]cc12.[CH3-].[K+] |
| InChI | InChI=1S/C10H7N4.CH3.K/c11-10-9-8(12-5-13-10)6-3-1-2-4-7(6)14-9;;/h2-5,14H,(H2,11,12,13);1H3;/q2*-1;+1 |
| InChIKey | YAFUJFJCBGZZGK-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;carbanide;5,8-dihydropyrimido[5,4-b]indol-8-id-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;carbanide;5,8-dihydropyrimido[5,4-b]indol-8-id-4-amine?
The IUPAC name of potassium;carbanide;5,8-dihydropyrimido[5,4-b]indol-8-id-4-amine (CID 153358363) is potassium;carbanide;5,8-dihydropyrimido[5,4-b]indol-8-id-4-amine.
What is the SMILES notation for potassium;carbanide;5,8-dihydropyrimido[5,4-b]indol-8-id-4-amine?
The canonical SMILES for potassium;carbanide;5,8-dihydropyrimido[5,4-b]indol-8-id-4-amine is Nc1ncnc2c1[nH]c1cc[c-]cc12.[CH3-].[K+].
What is the InChIKey of potassium;carbanide;5,8-dihydropyrimido[5,4-b]indol-8-id-4-amine?
The InChIKey is YAFUJFJCBGZZGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N4.CH3.K/c11-10-9-8(12-5-13-10)6-3-1-2-4-7(6)14-9;;/h2-5,14H,(H2,11,12,13);1H3;/q2*-1;+1.
What are the key properties of potassium;carbanide;5,8-dihydropyrimido[5,4-b]indol-8-id-4-amine?
potassium;carbanide;5,8-dihydropyrimido[5,4-b]indol-8-id-4-amine has a molecular weight of 237.33 g/mol, XLogP of -1.05, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;carbanide;5,8-dihydropyrimido[5,4-b]indol-8-id-4-amine is sourced from PubChem (CID 153358363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).