C28H28BN7O3 — CID 153358641
CID 153358641 (PubChem CID 153358641) has the molecular formula C28H28BN7O3 and a molecular weight of 521.39 g/mol.
| Compound Name | CID 153358641 |
|---|---|
| PubChem CID | 153358641 |
| Molecular Formula | C28H28BN7O3 |
| Molecular Weight | 521.39 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | — |
| SMILES | [B]CCOCCC(=O)N1CCc2cc(Cn3nc(-c4ccc5oc(C)nc5c4)c4c(N)ncnc43)ccc2C1 |
| InChI | InChI=1S/C28H28BN7O3/c1-17-33-22-13-20(4-5-23(22)39-17)26-25-27(30)31-16-32-28(25)36(34-26)14-18-2-3-21-15-35(9-6-19(21)12-18)24(37)7-10-38-11-8-29/h2-5,12-13,16H,6-11,14-15H2,1H3,(H2,30,31,32) |
| InChIKey | RLPGOHFLOLFLJH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|