C5H9BrClN3 — CID 153358693
(3E)-2-bromo-4-chloro-4-N-methylbuta-1,3-diene-1,1,4-triamine (PubChem CID 153358693) has the molecular formula C5H9BrClN3 and a molecular weight of 226.50 g/mol. Its IUPAC name is (3E)-2-bromo-4-chloro-4-N-methylbuta-1,3-diene-1,1,4-triamine.
| Compound Name | (3E)-2-bromo-4-chloro-4-N-methylbuta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 153358693 |
| Molecular Formula | C5H9BrClN3 |
| Molecular Weight | 226.50 g/mol |
| Exact Mass | 224.97 |
| IUPAC Name | (3E)-2-bromo-4-chloro-4-N-methylbuta-1,3-diene-1,1,4-triamine |
| SMILES | CN/C(Cl)=C\C(Br)=C(N)N |
| InChI | InChI=1S/C5H9BrClN3/c1-10-4(7)2-3(6)5(8)9/h2,10H,8-9H2,1H3/b4-2- |
| InChIKey | PUVORUHTVXECMJ-RQOWECAXSA-N |
| XLogP | 0.77 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.50 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|