C17H24ClN4O8PS — CID 153358989
[(2S,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid (PubChem CID 153358989) has the molecular formula C17H24ClN4O8PS and a molecular weight of 510.89 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid.
| Compound Name | [(2S,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
|---|---|
| PubChem CID | 153358989 |
| Molecular Formula | C17H24ClN4O8PS |
| Molecular Weight | 510.89 g/mol |
| Exact Mass | 510.07 |
| IUPAC Name | [(2S,3S,4R,5R)-5-[6-chloro-4-(cyclopentylamino)pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methylsulfonylmethylphosphonic acid |
| SMILES | O=P(O)(O)CS(=O)(=O)C[C@H]1O[C@@H](n2ncc3c(NC4CCCC4)cc(Cl)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H24ClN4O8PS/c18-13-5-11(20-9-3-1-2-4-9)10-6-19-22(16(10)21-13)17-15(24)14(23)12(30-17)7-32(28,29)8-31(25,26)27/h5-6,9,12,14-15,17,23-24H,1-4,7-8H2,(H,20,21)(H2,25,26,27)/t12-,14-,15-,17-/m1/s1 |
| InChIKey | KTILTPXUXDXIQJ-DNNBLBMLSA-N |
| XLogP | 0.61 |
| TPSA | 184.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.89 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|